C25H40O2 — CID 163034384
6-(2,10-dimethyl-13-methylidene-3-oxatetracyclo[10.3.0.02,4.06,10]pentadecan-7-yl)-2-methylhept-2-en-1-ol (PubChem CID 163034384) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is 6-(2,10-dimethyl-13-methylidene-3-oxatetracyclo[10.3.0.02,4.06,10]pentadecan-7-yl)-2-methylhept-2-en-1-ol.
| Compound Name | 6-(2,10-dimethyl-13-methylidene-3-oxatetracyclo[10.3.0.02,4.06,10]pentadecan-7-yl)-2-methylhept-2-en-1-ol |
|---|---|
| PubChem CID | 163034384 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | 6-(2,10-dimethyl-13-methylidene-3-oxatetracyclo[10.3.0.02,4.06,10]pentadecan-7-yl)-2-methylhept-2-en-1-ol |
| SMILES | C=C1CCC2C1CC1(C)CCC(C(C)CCC=C(C)CO)C1CC1OC12C |
| InChI | InChI=1S/C25H40O2/c1-16(15-26)7-6-8-17(2)19-11-12-24(4)14-20-18(3)9-10-21(20)25(5)23(27-25)13-22(19)24/h7,17,19-23,26H,3,6,8-15H2,1-2,4-5H3 |
| InChIKey | JPWWOAMPHFTWJX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|