C33H44O8 — CID 162992889
2-(7,16-diacetyloxy-4,8,10,14-tetramethyl-3,6-dioxo-5,7,9,11,12,13,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid (PubChem CID 162992889) has the molecular formula C33H44O8 and a molecular weight of 568.71 g/mol. Its IUPAC name is 2-(7,16-diacetyloxy-4,8,10,14-tetramethyl-3,6-dioxo-5,7,9,11,12,13,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid.
| Compound Name | 2-(7,16-diacetyloxy-4,8,10,14-tetramethyl-3,6-dioxo-5,7,9,11,12,13,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 162992889 |
| Molecular Formula | C33H44O8 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 2-(7,16-diacetyloxy-4,8,10,14-tetramethyl-3,6-dioxo-5,7,9,11,12,13,15,16-octahydro-4H-cyclopenta[a]phenanthren-17-ylidene)-6-methylhept-5-enoic acid |
| SMILES | CC(=O)OC1CC2(C)C(CCC3C4(C)C=CC(=O)C(C)C4C(=O)C(OC(C)=O)C32C)C1=C(CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C33H44O8/c1-17(2)10-9-11-21(30(38)39)26-22-12-13-25-31(6)15-14-23(36)18(3)27(31)28(37)29(41-20(5)35)33(25,8)32(22,7)16-24(26)40-19(4)34/h10,14-15,18,22,24-25,27,29H,9,11-13,16H2,1-8H3,(H,38,39) |
| InChIKey | AWYSBHUMEXWCCK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|