C31H46O5 — CID 154812627
(2E)-2-[(4S,5S,8S,9S,10S,13R,14S)-16-acetyloxy-4,8,10,14-tetramethyl-3-oxo-1,2,4,5,6,7,9,11,12,13,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoic acid (PubChem CID 154812627) has the molecular formula C31H46O5 and a molecular weight of 498.70 g/mol. Its IUPAC name is (2E)-2-[(4S,5S,8S,9S,10S,13R,14S)-16-acetyloxy-4,8,10,14-tetramethyl-3-oxo-1,2,4,5,6,7,9,11,12,13,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoic acid.
| Compound Name | (2E)-2-[(4S,5S,8S,9S,10S,13R,14S)-16-acetyloxy-4,8,10,14-tetramethyl-3-oxo-1,2,4,5,6,7,9,11,12,13,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 154812627 |
| Molecular Formula | C31H46O5 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | (2E)-2-[(4S,5S,8S,9S,10S,13R,14S)-16-acetyloxy-4,8,10,14-tetramethyl-3-oxo-1,2,4,5,6,7,9,11,12,13,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoic acid |
| SMILES | CC(=O)OC1C[C@@]2(C)[C@@H](CC[C@H]3[C@@]4(C)CCC(=O)[C@@H](C)[C@@H]4CC[C@@]32C)/C1=C(/CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C31H46O5/c1-18(2)9-8-10-21(28(34)35)27-23-11-12-26-29(5)15-14-24(33)19(3)22(29)13-16-30(26,6)31(23,7)17-25(27)36-20(4)32/h9,19,22-23,25-26H,8,10-17H2,1-7H3,(H,34,35)/b27-21+/t19-,22-,23-,25?,26-,29-,30-,31-/m0/s1 |
| InChIKey | QIDNRBJNYKMBHF-OIWFUHKESA-N |
| XLogP | 6.90 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|