C31H46O7 — CID 163005746
2-(4-acetyloxy-14-hydroxy-1,2,11,15-tetramethyl-9-oxo-8-oxatetracyclo[8.8.0.02,6.011,16]octadecan-5-ylidene)-6-methylhept-5-enoic acid (PubChem CID 163005746) has the molecular formula C31H46O7 and a molecular weight of 530.70 g/mol. Its IUPAC name is 2-(4-acetyloxy-14-hydroxy-1,2,11,15-tetramethyl-9-oxo-8-oxatetracyclo[8.8.0.02,6.011,16]octadecan-5-ylidene)-6-methylhept-5-enoic acid.
| Compound Name | 2-(4-acetyloxy-14-hydroxy-1,2,11,15-tetramethyl-9-oxo-8-oxatetracyclo[8.8.0.02,6.011,16]octadecan-5-ylidene)-6-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 163005746 |
| Molecular Formula | C31H46O7 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | 2-(4-acetyloxy-14-hydroxy-1,2,11,15-tetramethyl-9-oxo-8-oxatetracyclo[8.8.0.02,6.011,16]octadecan-5-ylidene)-6-methylhept-5-enoic acid |
| SMILES | CC(=O)OC1CC2(C)C(COC(=O)C3C4(C)CCC(O)C(C)C4CCC32C)C1=C(CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C31H46O7/c1-17(2)9-8-10-20(27(34)35)25-22-16-37-28(36)26-29(5)13-12-23(33)18(3)21(29)11-14-30(26,6)31(22,7)15-24(25)38-19(4)32/h9,18,21-24,26,33H,8,10-16H2,1-7H3,(H,34,35) |
| InChIKey | RXYYVWRVSPGGIO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|