C15H18O4 — CID 162993440
(3aR,5E,9E,11aR)-6-methyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-10-carboxylic acid (PubChem CID 162993440) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (3aR,5E,9E,11aR)-6-methyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-10-carboxylic acid.
| Compound Name | (3aR,5E,9E,11aR)-6-methyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-10-carboxylic acid |
|---|---|
| PubChem CID | 162993440 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (3aR,5E,9E,11aR)-6-methyl-3-methylidene-2-oxo-3a,4,7,8,11,11a-hexahydrocyclodeca[b]furan-10-carboxylic acid |
| SMILES | C=C1C(=O)O[C@@H]2C/C(C(=O)O)=C\CC/C(C)=C/C[C@H]12 |
| InChI | InChI=1S/C15H18O4/c1-9-4-3-5-11(14(16)17)8-13-12(7-6-9)10(2)15(18)19-13/h5-6,12-13H,2-4,7-8H2,1H3,(H,16,17)/b9-6+,11-5+/t12-,13-/m1/s1 |
| InChIKey | ZTCKLMZDVQRERE-LDQUVQIASA-N |
| XLogP | 2.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|