C24H26O10 — CID 162994127
methyl 2-[(4R,7R,8R,9R)-9-acetyloxy-5-(2-methoxy-2-oxoethylidene)-7,8-dimethyl-2,13,15-trioxatetracyclo[8.6.1.04,17.012,16]heptadeca-1(17),10,12(16)-trien-4-yl]-2-oxoacetate (PubChem CID 162994127) has the molecular formula C24H26O10 and a molecular weight of 474.46 g/mol. Its IUPAC name is methyl 2-[(4R,7R,8R,9R)-9-acetyloxy-5-(2-methoxy-2-oxoethylidene)-7,8-dimethyl-2,13,15-trioxatetracyclo[8.6.1.04,17.012,16]heptadeca-1(17),10,12(16)-trien-4-yl]-2-oxoacetate.
| Compound Name | methyl 2-[(4R,7R,8R,9R)-9-acetyloxy-5-(2-methoxy-2-oxoethylidene)-7,8-dimethyl-2,13,15-trioxatetracyclo[8.6.1.04,17.012,16]heptadeca-1(17),10,12(16)-trien-4-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 162994127 |
| Molecular Formula | C24H26O10 |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | methyl 2-[(4R,7R,8R,9R)-9-acetyloxy-5-(2-methoxy-2-oxoethylidene)-7,8-dimethyl-2,13,15-trioxatetracyclo[8.6.1.04,17.012,16]heptadeca-1(17),10,12(16)-trien-4-yl]-2-oxoacetate |
| SMILES | COC(=O)C=C1C[C@@H](C)[C@@H](C)[C@@H](OC(C)=O)c2cc3c(c4c2[C@@]1(C(=O)C(=O)OC)CO4)OCO3 |
| InChI | InChI=1S/C24H26O10/c1-11-6-14(7-17(26)29-4)24(22(27)23(28)30-5)9-31-21-18(24)15(8-16-20(21)33-10-32-16)19(12(11)2)34-13(3)25/h7-8,11-12,19H,6,9-10H2,1-5H3/t11-,12-,19-,24-/m1/s1 |
| InChIKey | IHGCEHKNZOZFOE-IRVUZVSDSA-N |
| XLogP | 2.17 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|