C29H32O13 — CID 163005588
methyl 12-acetyloxy-16-hydroxy-17-(2-methoxy-2-oxoethylidene)-13,14-dimethyl-18-(2-methylbut-2-enoyloxy)-3,6,8,15-tetraoxapentacyclo[12.2.2.11,4.05,9.011,19]nonadeca-4(19),5(9),10-triene-16-carboxylate (PubChem CID 163005588) has the molecular formula C29H32O13 and a molecular weight of 588.56 g/mol. Its IUPAC name is methyl 12-acetyloxy-16-hydroxy-17-(2-methoxy-2-oxoethylidene)-13,14-dimethyl-18-(2-methylbut-2-enoyloxy)-3,6,8,15-tetraoxapentacyclo[12.2.2.11,4.05,9.011,19]nonadeca-4(19),5(9),10-triene-16-carboxylate.
| Compound Name | methyl 12-acetyloxy-16-hydroxy-17-(2-methoxy-2-oxoethylidene)-13,14-dimethyl-18-(2-methylbut-2-enoyloxy)-3,6,8,15-tetraoxapentacyclo[12.2.2.11,4.05,9.011,19]nonadeca-4(19),5(9),10-triene-16-carboxylate |
|---|---|
| PubChem CID | 163005588 |
| Molecular Formula | C29H32O13 |
| Molecular Weight | 588.56 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | methyl 12-acetyloxy-16-hydroxy-17-(2-methoxy-2-oxoethylidene)-13,14-dimethyl-18-(2-methylbut-2-enoyloxy)-3,6,8,15-tetraoxapentacyclo[12.2.2.11,4.05,9.011,19]nonadeca-4(19),5(9),10-triene-16-carboxylate |
| SMILES | CC=C(C)C(=O)OC1C(=CC(=O)OC)C23COc4c5c(cc(c42)C(OC(C)=O)C(C)C1(C)OC3(O)C(=O)OC)OCO5 |
| InChI | InChI=1S/C29H32O13/c1-8-13(2)25(32)41-24-17(10-19(31)35-6)28-11-37-23-20(28)16(9-18-22(23)39-12-38-18)21(40-15(4)30)14(3)27(24,5)42-29(28,34)26(33)36-7/h8-10,14,21,24,34H,11-12H2,1-7H3 |
| InChIKey | OWCDINFBHOPCNP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 162.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.56 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|