C27H30O10 — CID 73324141
(14-hydroxy-19,20-dimethoxy-13,14-dimethyl-18-oxo-3,6,8,22-tetraoxahexacyclo[9.9.1.112,16.01,16.04,21.05,9]docosa-4(21),5(9),10,19-tetraen-15-yl) 2-methylbut-2-enoate (PubChem CID 73324141) has the molecular formula C27H30O10 and a molecular weight of 514.53 g/mol. Its IUPAC name is (14-hydroxy-19,20-dimethoxy-13,14-dimethyl-18-oxo-3,6,8,22-tetraoxahexacyclo[9.9.1.112,16.01,16.04,21.05,9]docosa-4(21),5(9),10,19-tetraen-15-yl) 2-methylbut-2-enoate.
| Compound Name | (14-hydroxy-19,20-dimethoxy-13,14-dimethyl-18-oxo-3,6,8,22-tetraoxahexacyclo[9.9.1.112,16.01,16.04,21.05,9]docosa-4(21),5(9),10,19-tetraen-15-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 73324141 |
| Molecular Formula | C27H30O10 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | (14-hydroxy-19,20-dimethoxy-13,14-dimethyl-18-oxo-3,6,8,22-tetraoxahexacyclo[9.9.1.112,16.01,16.04,21.05,9]docosa-4(21),5(9),10,19-tetraen-15-yl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(C)(O)C(C)C2OC13CC(=O)C(OC)=C(OC)C31COc3c4c(cc2c31)OCO4 |
| InChI | InChI=1S/C27H30O10/c1-7-12(2)23(29)36-24-25(4,30)13(3)18-14-8-16-20(35-11-34-16)21-17(14)26(10-33-21)22(32-6)19(31-5)15(28)9-27(24,26)37-18/h7-8,13,18,24,30H,9-11H2,1-6H3 |
| InChIKey | CFYJAQXOLYNIFQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|