C34H48O11 — CID 162995687
[(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-[4-hydroxy-2-[(9R)-9-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-5-methylphenoxy]oxan-2-yl]methyl acetate (PubChem CID 162995687) has the molecular formula C34H48O11 and a molecular weight of 632.75 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-[4-hydroxy-2-[(9R)-9-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-5-methylphenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-[4-hydroxy-2-[(9R)-9-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-5-methylphenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162995687 |
| Molecular Formula | C34H48O11 |
| Molecular Weight | 632.75 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-hydroxy-6-[4-hydroxy-2-[(9R)-9-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienyl]-5-methylphenoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Oc2cc(C)c(O)cc2CC=C(C)CCC=C(C)C[C@@H](O)C=C(C)C)[C@H](O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C34H48O11/c1-19(2)14-27(38)15-21(4)11-9-10-20(3)12-13-26-17-28(39)22(5)16-29(26)44-34-31(40)33(43-25(8)37)32(42-24(7)36)30(45-34)18-41-23(6)35/h11-12,14,16-17,27,30-34,38-40H,9-10,13,15,18H2,1-8H3/t27-,30+,31+,32+,33+,34-/m0/s1 |
| InChIKey | HFBNVWQEORGUAR-XRZDBFDYSA-N |
| XLogP | 4.52 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.75 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|