C32H50O8S — CID 162997502
[3,5-dihydroxy-1,1,4a,6a-tetramethyl-7-(5-methyl-4-methylidenehexyl)-2-sulfooxy-3,4,5,6,7,8,9,11,12,12a-decahydro-2H-chrysen-6-yl] acetate (PubChem CID 162997502) has the molecular formula C32H50O8S and a molecular weight of 594.81 g/mol. Its IUPAC name is [3,5-dihydroxy-1,1,4a,6a-tetramethyl-7-(5-methyl-4-methylidenehexyl)-2-sulfooxy-3,4,5,6,7,8,9,11,12,12a-decahydro-2H-chrysen-6-yl] acetate.
| Compound Name | [3,5-dihydroxy-1,1,4a,6a-tetramethyl-7-(5-methyl-4-methylidenehexyl)-2-sulfooxy-3,4,5,6,7,8,9,11,12,12a-decahydro-2H-chrysen-6-yl] acetate |
|---|---|
| PubChem CID | 162997502 |
| Molecular Formula | C32H50O8S |
| Molecular Weight | 594.81 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | [3,5-dihydroxy-1,1,4a,6a-tetramethyl-7-(5-methyl-4-methylidenehexyl)-2-sulfooxy-3,4,5,6,7,8,9,11,12,12a-decahydro-2H-chrysen-6-yl] acetate |
| SMILES | C=C(CCCC1CCC=C2C3=C(C(O)C(OC(C)=O)C21C)C1(C)CC(O)C(OS(=O)(=O)O)C(C)(C)C1CC3)C(C)C |
| InChI | InChI=1S/C32H50O8S/c1-18(2)19(3)11-9-12-21-13-10-14-23-22-15-16-25-30(5,6)28(40-41(36,37)38)24(34)17-31(25,7)26(22)27(35)29(32(21,23)8)39-20(4)33/h14,18,21,24-25,27-29,34-35H,3,9-13,15-17H2,1-2,4-8H3,(H,36,37,38) |
| InChIKey | IBROYZXNTWSQEI-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.81 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|