C42H68O7 — CID 163063234
[12-acetyloxy-2,11-dihydroxy-4,4,10,13-tetramethyl-17-(6-methyl-5-methylideneheptan-2-yl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 10-hydroxydecanoate (PubChem CID 163063234) has the molecular formula C42H68O7 and a molecular weight of 685.00 g/mol. Its IUPAC name is [12-acetyloxy-2,11-dihydroxy-4,4,10,13-tetramethyl-17-(6-methyl-5-methylideneheptan-2-yl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 10-hydroxydecanoate.
| Compound Name | [12-acetyloxy-2,11-dihydroxy-4,4,10,13-tetramethyl-17-(6-methyl-5-methylideneheptan-2-yl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 10-hydroxydecanoate |
|---|---|
| PubChem CID | 163063234 |
| Molecular Formula | C42H68O7 |
| Molecular Weight | 685.00 g/mol |
| Exact Mass | 684.50 |
| IUPAC Name | [12-acetyloxy-2,11-dihydroxy-4,4,10,13-tetramethyl-17-(6-methyl-5-methylideneheptan-2-yl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 10-hydroxydecanoate |
| SMILES | C=C(CCC(C)C1CC=C2C3=C(C(O)C(OC(C)=O)C21C)C1(C)CC(O)C(OC(=O)CCCCCCCCCO)C(C)(C)C1CC3)C(C)C |
| InChI | InChI=1S/C42H68O7/c1-26(2)27(3)18-19-28(4)31-21-22-32-30-20-23-34-40(6,7)38(49-35(46)17-15-13-11-10-12-14-16-24-43)33(45)25-41(34,8)36(30)37(47)39(42(31,32)9)48-29(5)44/h22,26,28,31,33-34,37-39,43,45,47H,3,10-21,23-25H2,1-2,4-9H3 |
| InChIKey | IGVGDAIOAPBYLG-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.00 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|