C30H44O3 — CID 162999854
(Z,6R)-6-[(4aS,6bR,9R,10aS,11bS)-4,4,6b,11b-tetramethyl-10-methylidene-3-oxo-1,2,4a,5,6,7,8,9,10a,11-decahydrobenzo[a]fluoren-9-yl]-2-methylhept-2-enoic acid (PubChem CID 162999854) has the molecular formula C30H44O3 and a molecular weight of 452.68 g/mol. Its IUPAC name is (Z,6R)-6-[(4aS,6bR,9R,10aS,11bS)-4,4,6b,11b-tetramethyl-10-methylidene-3-oxo-1,2,4a,5,6,7,8,9,10a,11-decahydrobenzo[a]fluoren-9-yl]-2-methylhept-2-enoic acid.
| Compound Name | (Z,6R)-6-[(4aS,6bR,9R,10aS,11bS)-4,4,6b,11b-tetramethyl-10-methylidene-3-oxo-1,2,4a,5,6,7,8,9,10a,11-decahydrobenzo[a]fluoren-9-yl]-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 162999854 |
| Molecular Formula | C30H44O3 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (Z,6R)-6-[(4aS,6bR,9R,10aS,11bS)-4,4,6b,11b-tetramethyl-10-methylidene-3-oxo-1,2,4a,5,6,7,8,9,10a,11-decahydrobenzo[a]fluoren-9-yl]-2-methylhept-2-enoic acid |
| SMILES | C=C1[C@@H]([C@H](C)CC/C=C(/C)C(=O)O)CC[C@@]2(C)C3=C(C[C@@H]12)[C@@]1(C)CCC(=O)C(C)(C)[C@H]1CC3 |
| InChI | InChI=1S/C30H44O3/c1-18(9-8-10-19(2)27(32)33)21-13-15-29(6)22-11-12-25-28(4,5)26(31)14-16-30(25,7)24(22)17-23(29)20(21)3/h10,18,21,23,25H,3,8-9,11-17H2,1-2,4-7H3,(H,32,33)/b19-10-/t18-,21-,23+,25-,29+,30-/m1/s1 |
| InChIKey | KXZSCUWAMZKCDF-XQCXZWNKSA-N |
| XLogP | 7.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|