C30H42O5 — CID 170910367
(E)-2-methyl-6-[(10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7,15-trioxo-1,2,5,6,11,12,16,17-octahydrocyclopenta[a]phenanthren-17-yl]hept-2-enoic acid (PubChem CID 170910367) has the molecular formula C30H42O5 and a molecular weight of 482.66 g/mol. Its IUPAC name is (E)-2-methyl-6-[(10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7,15-trioxo-1,2,5,6,11,12,16,17-octahydrocyclopenta[a]phenanthren-17-yl]hept-2-enoic acid.
| Compound Name | (E)-2-methyl-6-[(10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7,15-trioxo-1,2,5,6,11,12,16,17-octahydrocyclopenta[a]phenanthren-17-yl]hept-2-enoic acid |
|---|---|
| PubChem CID | 170910367 |
| Molecular Formula | C30H42O5 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | (E)-2-methyl-6-[(10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7,15-trioxo-1,2,5,6,11,12,16,17-octahydrocyclopenta[a]phenanthren-17-yl]hept-2-enoic acid |
| SMILES | C/C(=C\CCC(C)[C@H]1CC(=O)[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CCC(=O)C(C)(C)C1CC3=O)C(=O)O |
| InChI | InChI=1S/C30H42O5/c1-17(9-8-10-18(2)26(34)35)20-15-24(33)30(7)25-19(11-14-29(20,30)6)28(5)13-12-23(32)27(3,4)22(28)16-21(25)31/h10,17,20,22H,8-9,11-16H2,1-7H3,(H,34,35)/b18-10+/t17?,20-,22?,28-,29-,30+/m1/s1 |
| InChIKey | ILXKHZYGMNZALO-WPZFWQNJSA-N |
| XLogP | 6.11 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|