C31H46O4 — CID 163000186
methyl (E,6R)-6-[(5S,10S,13R,14R,15S,17R)-15-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoate (PubChem CID 163000186) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is methyl (E,6R)-6-[(5S,10S,13R,14R,15S,17R)-15-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoate.
| Compound Name | methyl (E,6R)-6-[(5S,10S,13R,14R,15S,17R)-15-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoate |
|---|---|
| PubChem CID | 163000186 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | methyl (E,6R)-6-[(5S,10S,13R,14R,15S,17R)-15-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoate |
| SMILES | COC(=O)/C(C)=C/CC[C@@H](C)[C@H]1C[C@H](O)[C@@]2(C)C3=CC[C@@H]4C(C)(C)C(=O)CC[C@]4(C)C3=CC[C@]12C |
| InChI | InChI=1S/C31H46O4/c1-19(10-9-11-20(2)27(34)35-8)23-18-26(33)31(7)22-12-13-24-28(3,4)25(32)15-16-29(24,5)21(22)14-17-30(23,31)6/h11-12,14,19,23-24,26,33H,9-10,13,15-18H2,1-8H3/b20-11+/t19-,23-,24-,26+,29-,30-,31-/m1/s1 |
| InChIKey | PZYKRMIXRNQHNG-SHFURUHOSA-N |
| XLogP | 6.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|