C31H46O4 — CID 46843486
(2R)-2-[(14R,15S)-15-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid (PubChem CID 46843486) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is (2R)-2-[(14R,15S)-15-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid.
| Compound Name | (2R)-2-[(14R,15S)-15-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid |
|---|---|
| PubChem CID | 46843486 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | (2R)-2-[(14R,15S)-15-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid |
| SMILES | C=C(CC[C@@H](C(=O)O)C1C[C@H](O)[C@@]2(C)C3=CCC4C(C)(C)C(=O)CCC4(C)C3=CCC12C)C(C)C |
| InChI | InChI=1S/C31H46O4/c1-18(2)19(3)9-10-20(27(34)35)23-17-26(33)31(8)22-11-12-24-28(4,5)25(32)14-15-29(24,6)21(22)13-16-30(23,31)7/h11,13,18,20,23-24,26,33H,3,9-10,12,14-17H2,1-2,4-8H3,(H,34,35)/t20-,23?,24?,26+,29?,30?,31-/m1/s1 |
| InChIKey | OSACBIMFKXGCAD-JFOKSMEBSA-N |
| XLogP | 6.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|