C31H48O4 — CID 67333992
(2R)-2-[(10S,13R,14R,15S,17R)-15-hydroxy-14-(hydroxymethyl)-4,4,10,13-tetramethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid (PubChem CID 67333992) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is (2R)-2-[(10S,13R,14R,15S,17R)-15-hydroxy-14-(hydroxymethyl)-4,4,10,13-tetramethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid.
| Compound Name | (2R)-2-[(10S,13R,14R,15S,17R)-15-hydroxy-14-(hydroxymethyl)-4,4,10,13-tetramethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid |
|---|---|
| PubChem CID | 67333992 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | (2R)-2-[(10S,13R,14R,15S,17R)-15-hydroxy-14-(hydroxymethyl)-4,4,10,13-tetramethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid |
| SMILES | C=C(CC[C@@H](C(=O)O)[C@H]1C[C@H](O)[C@@]2(CO)C3=CCC4C(C)(C)CCC[C@]4(C)C3=CC[C@]12C)C(C)C |
| InChI | InChI=1S/C31H48O4/c1-19(2)20(3)9-10-21(27(34)35)24-17-26(33)31(18-32)23-11-12-25-28(4,5)14-8-15-29(25,6)22(23)13-16-30(24,31)7/h11,13,19,21,24-26,32-33H,3,8-10,12,14-18H2,1-2,4-7H3,(H,34,35)/t21-,24-,25?,26+,29-,30-,31-/m1/s1 |
| InChIKey | NZAKHHWCACXEEU-JTVKSCOQSA-N |
| XLogP | 6.54 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|