C32H48O5 — CID 162864804
(2R)-2-[(3S,5S,10R,13R,14R,15S,17R)-15-acetyloxy-3-hydroxy-4,4,13,14-tetramethyl-1,2,3,5,6,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid (PubChem CID 162864804) has the molecular formula C32H48O5 and a molecular weight of 512.73 g/mol. Its IUPAC name is (2R)-2-[(3S,5S,10R,13R,14R,15S,17R)-15-acetyloxy-3-hydroxy-4,4,13,14-tetramethyl-1,2,3,5,6,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid.
| Compound Name | (2R)-2-[(3S,5S,10R,13R,14R,15S,17R)-15-acetyloxy-3-hydroxy-4,4,13,14-tetramethyl-1,2,3,5,6,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid |
|---|---|
| PubChem CID | 162864804 |
| Molecular Formula | C32H48O5 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | (2R)-2-[(3S,5S,10R,13R,14R,15S,17R)-15-acetyloxy-3-hydroxy-4,4,13,14-tetramethyl-1,2,3,5,6,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-6-methyl-5-methylideneheptanoic acid |
| SMILES | C=C(CC[C@@H](C(=O)O)[C@H]1C[C@H](OC(C)=O)[C@@]2(C)C3=CC[C@H]4[C@@H](CC[C@H](O)C4(C)C)C3=CC[C@]12C)C(C)C |
| InChI | InChI=1S/C32H48O5/c1-18(2)19(3)9-10-23(29(35)36)26-17-28(37-20(4)33)32(8)25-13-12-24-21(11-14-27(34)30(24,5)6)22(25)15-16-31(26,32)7/h13,15,18,21,23-24,26-28,34H,3,9-12,14,16-17H2,1-2,4-8H3,(H,35,36)/t21-,23+,24-,26+,27-,28-,31+,32+/m0/s1 |
| InChIKey | SLWXFSGQMUTGGV-QYLMLSRNSA-N |
| XLogP | 6.72 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|