C29H50O2 — CID 163001014
methyl (Z)-9-[(2R)-2-[(Z)-hexadec-7-enyl]cyclopropylidene]non-5-enoate (PubChem CID 163001014) has the molecular formula C29H50O2 and a molecular weight of 430.72 g/mol. Its IUPAC name is methyl (Z)-9-[(2R)-2-[(Z)-hexadec-7-enyl]cyclopropylidene]non-5-enoate.
| Compound Name | methyl (Z)-9-[(2R)-2-[(Z)-hexadec-7-enyl]cyclopropylidene]non-5-enoate |
|---|---|
| PubChem CID | 163001014 |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | methyl (Z)-9-[(2R)-2-[(Z)-hexadec-7-enyl]cyclopropylidene]non-5-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCC[C@@H]1CC1=CCC/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C29H50O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-17-20-23-27-26-28(27)24-21-18-15-16-19-22-25-29(30)31-2/h10-11,15-16,24,27H,3-9,12-14,17-23,25-26H2,1-2H3/b11-10-,16-15-,28-24?/t27-/m1/s1 |
| InChIKey | HCWIXAXJEZSZPL-LVSVZNFMSA-N |
| XLogP | 9.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|