C27H24N2O3 — CID 163002430
3-methyl-2-phenyl-8-(2-pyridin-3-ylpiperidine-1-carbonyl)chromen-4-one (PubChem CID 163002430) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-methyl-2-phenyl-8-(2-pyridin-3-ylpiperidine-1-carbonyl)chromen-4-one.
| Compound Name | 3-methyl-2-phenyl-8-(2-pyridin-3-ylpiperidine-1-carbonyl)chromen-4-one |
|---|---|
| PubChem CID | 163002430 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3-methyl-2-phenyl-8-(2-pyridin-3-ylpiperidine-1-carbonyl)chromen-4-one |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)N3CCCCC3c3cccnc3)cccc2c1=O |
| InChI | InChI=1S/C27H24N2O3/c1-18-24(30)21-12-7-13-22(26(21)32-25(18)19-9-3-2-4-10-19)27(31)29-16-6-5-14-23(29)20-11-8-15-28-17-20/h2-4,7-13,15,17,23H,5-6,14,16H2,1H3 |
| InChIKey | SKFXCFJWMZBYFR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |