C40H48N4O2 — CID 163002775
methyl 6-(15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-16-yl)-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylate (PubChem CID 163002775) has the molecular formula C40H48N4O2 and a molecular weight of 616.85 g/mol. Its IUPAC name is methyl 6-(15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-16-yl)-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylate.
| Compound Name | methyl 6-(15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-16-yl)-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylate |
|---|---|
| PubChem CID | 163002775 |
| Molecular Formula | C40H48N4O2 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | methyl 6-(15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-16-yl)-2,12-diazahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3(8),4,6-triene-18-carboxylate |
| SMILES | CCC12CCCN3CCc4c(n(c5ccccc45)CC1c1ccc4c(c1)C15CCN6CCCC7(CCC1(N4)C(C(=O)OC)C7)C65)C32 |
| InChI | InChI=1S/C40H48N4O2/c1-3-38-14-7-18-42-20-12-27-26-8-4-5-9-32(26)44(33(27)34(38)42)24-30(38)25-10-11-31-28(22-25)39-17-21-43-19-6-13-37(36(39)43)15-16-40(39,41-31)29(23-37)35(45)46-2/h4-5,8-11,22,29-30,34,36,41H,3,6-7,12-21,23-24H2,1-2H3 |
| InChIKey | GYSBHMIJASRZSN-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|