C40H48N4O2 — CID 163103743
methyl 12-ethyl-10-(15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-16-yl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-10-carboxylate (PubChem CID 163103743) has the molecular formula C40H48N4O2 and a molecular weight of 616.85 g/mol. Its IUPAC name is methyl 12-ethyl-10-(15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-16-yl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-10-carboxylate.
| Compound Name | methyl 12-ethyl-10-(15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-16-yl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 163103743 |
| Molecular Formula | C40H48N4O2 |
| Molecular Weight | 616.85 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | methyl 12-ethyl-10-(15-ethyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-16-yl)-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-10-carboxylate |
| SMILES | CCC12C=CCN3CCC4(c5ccccc5NC4C(C(=O)OC)(C4Cn5c6c(c7ccccc75)CCN5CCCC4(CC)C65)C1)C32 |
| InChI | InChI=1S/C40H48N4O2/c1-4-37-17-10-21-43-23-19-39(35(37)43)28-13-7-8-14-29(28)41-34(39)40(25-37,36(45)46-3)31-24-44-30-15-9-6-12-26(30)27-16-22-42-20-11-18-38(31,5-2)33(42)32(27)44/h6-10,12-15,17,31,33-35,41H,4-5,11,16,18-25H2,1-3H3 |
| InChIKey | CUAUZYBIYIHENN-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.85 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|