C28H34O6 — CID 163004338
[(2S,3R,5S)-2-[(1R,2S,4S,5R,10R,11S)-5-hydroxy-10-methyl-9-oxo-3-oxapentacyclo[9.8.0.02,4.05,10.014,19]nonadeca-7,14(19),15,17-tetraen-16-yl]-5-methyl-6-oxoheptan-3-yl] formate (PubChem CID 163004338) has the molecular formula C28H34O6 and a molecular weight of 466.57 g/mol. Its IUPAC name is [(2S,3R,5S)-2-[(1R,2S,4S,5R,10R,11S)-5-hydroxy-10-methyl-9-oxo-3-oxapentacyclo[9.8.0.02,4.05,10.014,19]nonadeca-7,14(19),15,17-tetraen-16-yl]-5-methyl-6-oxoheptan-3-yl] formate.
| Compound Name | [(2S,3R,5S)-2-[(1R,2S,4S,5R,10R,11S)-5-hydroxy-10-methyl-9-oxo-3-oxapentacyclo[9.8.0.02,4.05,10.014,19]nonadeca-7,14(19),15,17-tetraen-16-yl]-5-methyl-6-oxoheptan-3-yl] formate |
|---|---|
| PubChem CID | 163004338 |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | [(2S,3R,5S)-2-[(1R,2S,4S,5R,10R,11S)-5-hydroxy-10-methyl-9-oxo-3-oxapentacyclo[9.8.0.02,4.05,10.014,19]nonadeca-7,14(19),15,17-tetraen-16-yl]-5-methyl-6-oxoheptan-3-yl] formate |
| SMILES | CC(=O)[C@@H](C)C[C@@H](OC=O)[C@@H](C)c1ccc2c(c1)CC[C@H]1[C@H]2[C@@H]2O[C@@H]2[C@@]2(O)CC=CC(=O)[C@]12C |
| InChI | InChI=1S/C28H34O6/c1-15(17(3)30)12-22(33-14-29)16(2)18-7-9-20-19(13-18)8-10-21-24(20)25-26(34-25)28(32)11-5-6-23(31)27(21,28)4/h5-7,9,13-16,21-22,24-26,32H,8,10-12H2,1-4H3/t15-,16-,21-,22+,24-,25-,26-,27-,28-/m0/s1 |
| InChIKey | BZBJAFGFMNCGBB-ZFHQNSHKSA-N |
| XLogP | 3.64 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|