C28H38O7 — CID 163073317
[2-(5,17-dihydroxy-10,14-dimethyl-9-oxo-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadeca-7,15-dien-15-yl)-5-methyl-6-oxoheptan-3-yl] formate (PubChem CID 163073317) has the molecular formula C28H38O7 and a molecular weight of 486.61 g/mol. Its IUPAC name is [2-(5,17-dihydroxy-10,14-dimethyl-9-oxo-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadeca-7,15-dien-15-yl)-5-methyl-6-oxoheptan-3-yl] formate.
| Compound Name | [2-(5,17-dihydroxy-10,14-dimethyl-9-oxo-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadeca-7,15-dien-15-yl)-5-methyl-6-oxoheptan-3-yl] formate |
|---|---|
| PubChem CID | 163073317 |
| Molecular Formula | C28H38O7 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | [2-(5,17-dihydroxy-10,14-dimethyl-9-oxo-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadeca-7,15-dien-15-yl)-5-methyl-6-oxoheptan-3-yl] formate |
| SMILES | CC(=O)C(C)CC(OC=O)C(C)C1=CC(O)C2C3C4OC4C4(O)CC=CC(=O)C4(C)C3CCC12C |
| InChI | InChI=1S/C28H38O7/c1-14(16(3)30)11-20(34-13-29)15(2)18-12-19(31)23-22-17(8-10-26(18,23)4)27(5)21(32)7-6-9-28(27,33)25-24(22)35-25/h6-7,12-15,17,19-20,22-25,31,33H,8-11H2,1-5H3 |
| InChIKey | UMJONRKNIGJNHH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|