C15H16O5 — CID 163005695
[2-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-2-oxoethyl] acetate (PubChem CID 163005695) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is [2-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-2-oxoethyl] acetate.
| Compound Name | [2-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 163005695 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | [2-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)c1ccc2c(c1)C(=O)CC(C)(C)O2 |
| InChI | InChI=1S/C15H16O5/c1-9(16)19-8-13(18)10-4-5-14-11(6-10)12(17)7-15(2,3)20-14/h4-6H,7-8H2,1-3H3 |
| InChIKey | BKHBZDUSQIRDOK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |