C20H21NO3 — CID 108805240
N-(4-ethylphenyl)-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide (PubChem CID 108805240) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide.
| Compound Name | N-(4-ethylphenyl)-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide |
|---|---|
| PubChem CID | 108805240 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-(4-ethylphenyl)-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2ccc3c(c2)C(=O)CC(C)(C)O3)cc1 |
| InChI | InChI=1S/C20H21NO3/c1-4-13-5-8-15(9-6-13)21-19(23)14-7-10-18-16(11-14)17(22)12-20(2,3)24-18/h5-11H,4,12H2,1-3H3,(H,21,23) |
| InChIKey | NZNIKGIFTBJOSN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |