C18H15Cl2NO4 — CID 108805246
N-(3,5-dichloro-4-hydroxyphenyl)-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide (PubChem CID 108805246) has the molecular formula C18H15Cl2NO4 and a molecular weight of 380.23 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide |
|---|---|
| PubChem CID | 108805246 |
| Molecular Formula | C18H15Cl2NO4 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide |
| SMILES | CC1(C)CC(=O)c2cc(C(=O)Nc3cc(Cl)c(O)c(Cl)c3)ccc2O1 |
| InChI | InChI=1S/C18H15Cl2NO4/c1-18(2)8-14(22)11-5-9(3-4-15(11)25-18)17(24)21-10-6-12(19)16(23)13(20)7-10/h3-7,23H,8H2,1-2H3,(H,21,24) |
| InChIKey | IQEVIXAHPWWYRC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|