C18H16INO3 — CID 108793309
N-(4-iodophenyl)-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide (PubChem CID 108793309) has the molecular formula C18H16INO3 and a molecular weight of 421.23 g/mol. Its IUPAC name is N-(4-iodophenyl)-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide.
| Compound Name | N-(4-iodophenyl)-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide |
|---|---|
| PubChem CID | 108793309 |
| Molecular Formula | C18H16INO3 |
| Molecular Weight | 421.23 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | N-(4-iodophenyl)-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide |
| SMILES | CC1(C)CC(=O)c2cc(C(=O)Nc3ccc(I)cc3)ccc2O1 |
| InChI | InChI=1S/C18H16INO3/c1-18(2)10-15(21)14-9-11(3-8-16(14)23-18)17(22)20-13-6-4-12(19)5-7-13/h3-9H,10H2,1-2H3,(H,20,22) |
| InChIKey | UESZMUKVRVMDND-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|