C20H20N2O6S — CID 108793317
N-[4-(acetylsulfamoyl)phenyl]-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide (PubChem CID 108793317) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide |
|---|---|
| PubChem CID | 108793317 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-2,2-dimethyl-4-oxo-3H-chromene-6-carboxamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)c2ccc3c(c2)C(=O)CC(C)(C)O3)cc1 |
| InChI | InChI=1S/C20H20N2O6S/c1-12(23)22-29(26,27)15-7-5-14(6-8-15)21-19(25)13-4-9-18-16(10-13)17(24)11-20(2,3)28-18/h4-10H,11H2,1-3H3,(H,21,25)(H,22,23) |
| InChIKey | QHRYJLMGKCKRBH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |