C19H17NO6 — CID 108744223
4-[(2,2-dimethyl-4-oxo-3H-chromene-6-carbonyl)amino]-3-hydroxybenzoic acid (PubChem CID 108744223) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-4-oxo-3H-chromene-6-carbonyl)amino]-3-hydroxybenzoic acid.
| Compound Name | 4-[(2,2-dimethyl-4-oxo-3H-chromene-6-carbonyl)amino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108744223 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-[(2,2-dimethyl-4-oxo-3H-chromene-6-carbonyl)amino]-3-hydroxybenzoic acid |
| SMILES | CC1(C)CC(=O)c2cc(C(=O)Nc3ccc(C(=O)O)cc3O)ccc2O1 |
| InChI | InChI=1S/C19H17NO6/c1-19(2)9-15(22)12-7-10(4-6-16(12)26-19)17(23)20-13-5-3-11(18(24)25)8-14(13)21/h3-8,21H,9H2,1-2H3,(H,20,23)(H,24,25) |
| InChIKey | FVYCZVBCIBGJQH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|