C15H28O3 — CID 163008999
(3S)-2-methyl-5-[(1R,3S,4S,7R)-1,3,7-trimethyl-2-oxabicyclo[2.2.1]heptan-3-yl]pentane-2,3-diol (PubChem CID 163008999) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (3S)-2-methyl-5-[(1R,3S,4S,7R)-1,3,7-trimethyl-2-oxabicyclo[2.2.1]heptan-3-yl]pentane-2,3-diol.
| Compound Name | (3S)-2-methyl-5-[(1R,3S,4S,7R)-1,3,7-trimethyl-2-oxabicyclo[2.2.1]heptan-3-yl]pentane-2,3-diol |
|---|---|
| PubChem CID | 163008999 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (3S)-2-methyl-5-[(1R,3S,4S,7R)-1,3,7-trimethyl-2-oxabicyclo[2.2.1]heptan-3-yl]pentane-2,3-diol |
| SMILES | C[C@@H]1[C@@H]2CC[C@@]1(C)O[C@@]2(C)CC[C@H](O)C(C)(C)O |
| InChI | InChI=1S/C15H28O3/c1-10-11-6-8-14(10,4)18-15(11,5)9-7-12(16)13(2,3)17/h10-12,16-17H,6-9H2,1-5H3/t10-,11+,12+,14-,15+/m1/s1 |
| InChIKey | RZJPJRLNBRMDTP-NUNXZZDCSA-N |
| XLogP | 2.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |