C30H52O6 — CID 163010212
17-(6-hydroperoxy-2-hydroxy-6-methylhept-4-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11,12-triol (PubChem CID 163010212) has the molecular formula C30H52O6 and a molecular weight of 508.74 g/mol. Its IUPAC name is 17-(6-hydroperoxy-2-hydroxy-6-methylhept-4-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11,12-triol.
| Compound Name | 17-(6-hydroperoxy-2-hydroxy-6-methylhept-4-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11,12-triol |
|---|---|
| PubChem CID | 163010212 |
| Molecular Formula | C30H52O6 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | 17-(6-hydroperoxy-2-hydroxy-6-methylhept-4-en-2-yl)-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11,12-triol |
| SMILES | CC(C)(C=CCC(C)(O)C1CCC2(C)C1C(O)C(O)C1C3(C)CCC(O)C(C)(C)C3CCC12C)OO |
| InChI | InChI=1S/C30H52O6/c1-25(2,36-35)13-9-14-30(8,34)18-10-16-28(6)21(18)22(32)23(33)24-27(5)15-12-20(31)26(3,4)19(27)11-17-29(24,28)7/h9,13,18-24,31-35H,10-12,14-17H2,1-8H3 |
| InChIKey | PIBYHSHUZIRXDG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|