C30H52O4 — CID 90956955
(3S,8R,9R,10R,13S,14S,16S,17R)-17-[(2S)-2,6-dihydroxy-6-methylhept-4-en-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 90956955) has the molecular formula C30H52O4 and a molecular weight of 476.74 g/mol. Its IUPAC name is (3S,8R,9R,10R,13S,14S,16S,17R)-17-[(2S)-2,6-dihydroxy-6-methylhept-4-en-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (3S,8R,9R,10R,13S,14S,16S,17R)-17-[(2S)-2,6-dihydroxy-6-methylhept-4-en-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 90956955 |
| Molecular Formula | C30H52O4 |
| Molecular Weight | 476.74 g/mol |
| Exact Mass | 476.39 |
| IUPAC Name | (3S,8R,9R,10R,13S,14S,16S,17R)-17-[(2S)-2,6-dihydroxy-6-methylhept-4-en-2-yl]-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | CC(C)(O)C=CC[C@](C)(O)[C@H]1[C@@H](O)C[C@@]2(C)[C@H]1CC[C@@H]1[C@@]3(C)CC[C@H](O)C(C)(C)C3CC[C@]12C |
| InChI | InChI=1S/C30H52O4/c1-25(2,33)14-9-15-30(8,34)24-19-10-11-22-27(5)16-13-23(32)26(3,4)21(27)12-17-28(22,6)29(19,7)18-20(24)31/h9,14,19-24,31-34H,10-13,15-18H2,1-8H3/t19-,20-,21?,22+,23-,24+,27-,28+,29-,30-/m0/s1 |
| InChIKey | MUBXJZNIPHBTRG-CFXZEKJWSA-N |
| XLogP | 5.47 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.74 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|