C20H32O3 — CID 163010453
(3R)-5-[(1S,3E,5S,7E,11S)-8-(hydroxymethyl)-1,5-dimethyl-12-oxabicyclo[9.1.0]dodeca-3,7-dien-5-yl]-2-methylpent-1-en-3-ol (PubChem CID 163010453) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (3R)-5-[(1S,3E,5S,7E,11S)-8-(hydroxymethyl)-1,5-dimethyl-12-oxabicyclo[9.1.0]dodeca-3,7-dien-5-yl]-2-methylpent-1-en-3-ol.
| Compound Name | (3R)-5-[(1S,3E,5S,7E,11S)-8-(hydroxymethyl)-1,5-dimethyl-12-oxabicyclo[9.1.0]dodeca-3,7-dien-5-yl]-2-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 163010453 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (3R)-5-[(1S,3E,5S,7E,11S)-8-(hydroxymethyl)-1,5-dimethyl-12-oxabicyclo[9.1.0]dodeca-3,7-dien-5-yl]-2-methylpent-1-en-3-ol |
| SMILES | C=C(C)[C@H](O)CC[C@]1(C)/C=C/C[C@]2(C)O[C@H]2CC/C(CO)=C\C1 |
| InChI | InChI=1S/C20H32O3/c1-15(2)17(22)9-13-19(3)10-5-11-20(4)18(23-20)7-6-16(14-21)8-12-19/h5,8,10,17-18,21-22H,1,6-7,9,11-14H2,2-4H3/b10-5+,16-8+/t17-,18+,19-,20+/m1/s1 |
| InChIKey | RTUZORNRPXKYFG-SQZQTGHLSA-N |
| XLogP | 3.92 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|