C21H32O4 — CID 71520811
methyl (1R,4Z,6E,10R,11E,14S)-10-hydroxy-10,14-dimethyl-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,11-triene-4-carboxylate (PubChem CID 71520811) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is methyl (1R,4Z,6E,10R,11E,14S)-10-hydroxy-10,14-dimethyl-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,11-triene-4-carboxylate.
| Compound Name | methyl (1R,4Z,6E,10R,11E,14S)-10-hydroxy-10,14-dimethyl-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,11-triene-4-carboxylate |
|---|---|
| PubChem CID | 71520811 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | methyl (1R,4Z,6E,10R,11E,14S)-10-hydroxy-10,14-dimethyl-7-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,6,11-triene-4-carboxylate |
| SMILES | COC(=O)/C1=C\C=C(\C(C)C)CC[C@@](C)(O)/C=C/C[C@]2(C)O[C@@H]2CC1 |
| InChI | InChI=1S/C21H32O4/c1-15(2)16-7-8-17(19(22)24-5)9-10-18-21(4,25-18)13-6-12-20(3,23)14-11-16/h6-8,12,15,18,23H,9-11,13-14H2,1-5H3/b12-6+,16-7+,17-8-/t18-,20+,21+/m1/s1 |
| InChIKey | BVJUMQYSTBMEPO-QMGVNSBISA-N |
| XLogP | 4.10 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|