C32H46O4 — CID 163010721
(1S,8R,9R,10S)-9-methyl-6,10-bis(3-methylbut-2-enyl)-9-(4-methylpent-3-enyl)-8-(2-methylpropanoyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione (PubChem CID 163010721) has the molecular formula C32H46O4 and a molecular weight of 494.72 g/mol. Its IUPAC name is (1S,8R,9R,10S)-9-methyl-6,10-bis(3-methylbut-2-enyl)-9-(4-methylpent-3-enyl)-8-(2-methylpropanoyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione.
| Compound Name | (1S,8R,9R,10S)-9-methyl-6,10-bis(3-methylbut-2-enyl)-9-(4-methylpent-3-enyl)-8-(2-methylpropanoyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
|---|---|
| PubChem CID | 163010721 |
| Molecular Formula | C32H46O4 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | (1S,8R,9R,10S)-9-methyl-6,10-bis(3-methylbut-2-enyl)-9-(4-methylpent-3-enyl)-8-(2-methylpropanoyl)-4-oxatricyclo[6.3.1.01,5]dodec-5-ene-7,12-dione |
| SMILES | CC(C)=CCC[C@]1(C)[C@@H](CC=C(C)C)C[C@]23CCOC2=C(CC=C(C)C)C(=O)[C@@]1(C(=O)C(C)C)C3=O |
| InChI | InChI=1S/C32H46O4/c1-20(2)11-10-16-30(9)24(14-12-21(3)4)19-31-17-18-36-28(31)25(15-13-22(5)6)27(34)32(30,29(31)35)26(33)23(7)8/h11-13,23-24H,10,14-19H2,1-9H3/t24-,30+,31+,32-/m0/s1 |
| InChIKey | UFLRPJGNURHISL-FTVIZOJLSA-N |
| XLogP | 7.50 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|