C20H26O5 — CID 163011786
9,18-dihydroxy-7,7-dimethyl-17-methylidene-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadec-14-en-2-one (PubChem CID 163011786) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is 9,18-dihydroxy-7,7-dimethyl-17-methylidene-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadec-14-en-2-one.
| Compound Name | 9,18-dihydroxy-7,7-dimethyl-17-methylidene-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadec-14-en-2-one |
|---|---|
| PubChem CID | 163011786 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 9,18-dihydroxy-7,7-dimethyl-17-methylidene-3,10-dioxapentacyclo[14.2.1.01,13.04,12.08,12]nonadec-14-en-2-one |
| SMILES | C=C1C2C=CC3C(C2)(C(=O)OC2CCC(C)(C)C4C(O)OCC243)C1O |
| InChI | InChI=1S/C20H26O5/c1-10-11-4-5-12-19(8-11,15(10)21)17(23)25-13-6-7-18(2,3)14-16(22)24-9-20(12,13)14/h4-5,11-16,21-22H,1,6-9H2,2-3H3 |
| InChIKey | SALXTEMFWBBTBS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|