C20H29ClO3 — CID 163012442
(1R,2S,8Z,11E,14Z,16R,17R,18R)-18-chloro-2-ethyl-17-hydroxy-3-oxabicyclo[14.3.0]nonadeca-8,11,14-trien-4-one (PubChem CID 163012442) has the molecular formula C20H29ClO3 and a molecular weight of 352.90 g/mol. Its IUPAC name is (1R,2S,8Z,11E,14Z,16R,17R,18R)-18-chloro-2-ethyl-17-hydroxy-3-oxabicyclo[14.3.0]nonadeca-8,11,14-trien-4-one.
| Compound Name | (1R,2S,8Z,11E,14Z,16R,17R,18R)-18-chloro-2-ethyl-17-hydroxy-3-oxabicyclo[14.3.0]nonadeca-8,11,14-trien-4-one |
|---|---|
| PubChem CID | 163012442 |
| Molecular Formula | C20H29ClO3 |
| Molecular Weight | 352.90 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (1R,2S,8Z,11E,14Z,16R,17R,18R)-18-chloro-2-ethyl-17-hydroxy-3-oxabicyclo[14.3.0]nonadeca-8,11,14-trien-4-one |
| SMILES | CC[C@@H]1OC(=O)CCC/C=C\C/C=C/C/C=C\[C@H]2[C@@H](O)[C@H](Cl)C[C@H]21 |
| InChI | InChI=1S/C20H29ClO3/c1-2-18-16-14-17(21)20(23)15(16)12-10-8-6-4-3-5-7-9-11-13-19(22)24-18/h4-7,10,12,15-18,20,23H,2-3,8-9,11,13-14H2,1H3/b6-4+,7-5-,12-10-/t15-,16-,17-,18+,20-/m1/s1 |
| InChIKey | XSVVTBMSEOBKQC-OSTDIXBNSA-N |
| XLogP | 4.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.90 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|