C43H72NO8P — CID 163013507
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-9,12,15-trienoyloxypropyl] icosa-5,8,11,14-tetraenoate (PubChem CID 163013507) has the molecular formula C43H72NO8P and a molecular weight of 762.02 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-9,12,15-trienoyloxypropyl] icosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-9,12,15-trienoyloxypropyl] icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 163013507 |
| Molecular Formula | C43H72NO8P |
| Molecular Weight | 762.02 g/mol |
| Exact Mass | 761.50 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-9,12,15-trienoyloxypropyl] icosa-5,8,11,14-tetraenoate |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)O[C@H](COC(=O)CCCC=CCC=CCC=CCC=CCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C43H72NO8P/c1-3-5-7-9-11-13-15-17-19-20-22-23-25-27-29-31-33-35-42(45)49-39-41(40-51-53(47,48)50-38-37-44)52-43(46)36-34-32-30-28-26-24-21-18-16-14-12-10-8-6-4-2/h6,8,11-14,17-19,21-23,27,29,41H,3-5,7,9-10,15-16,20,24-26,28,30-40,44H2,1-2H3,(H,47,48)/t41-/m1/s1 |
| InChIKey | CBWHTIRQEJCNCV-VQJSHJPSSA-N |
| XLogP | 11.27 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.02 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|