C43H72NO8P — CID 75957373
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octadeca-9,12-dienoyloxypropan-2-yl] icosa-5,8,11,14,17-pentaenoate (PubChem CID 75957373) has the molecular formula C43H72NO8P and a molecular weight of 762.02 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octadeca-9,12-dienoyloxypropan-2-yl] icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octadeca-9,12-dienoyloxypropan-2-yl] icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 75957373 |
| Molecular Formula | C43H72NO8P |
| Molecular Weight | 762.02 g/mol |
| Exact Mass | 761.50 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-octadeca-9,12-dienoyloxypropan-2-yl] icosa-5,8,11,14,17-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C43H72NO8P/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-36-43(46)52-41(40-51-53(47,48)50-38-37-44)39-49-42(45)35-33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h5,7,11-14,17-19,21-22,24,28,30,41H,3-4,6,8-10,15-16,20,23,25-27,29,31-40,44H2,1-2H3,(H,47,48) |
| InChIKey | AJTJVNKPLZTLHV-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.02 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|