C29H42O11 — CID 163016430
5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-(2,3,4,5-tetrahydroxy-6-methyloxan-2-yl)oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde (PubChem CID 163016430) has the molecular formula C29H42O11 and a molecular weight of 566.64 g/mol. Its IUPAC name is 5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-(2,3,4,5-tetrahydroxy-6-methyloxan-2-yl)oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde.
| Compound Name | 5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-(2,3,4,5-tetrahydroxy-6-methyloxan-2-yl)oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
|---|---|
| PubChem CID | 163016430 |
| Molecular Formula | C29H42O11 |
| Molecular Weight | 566.64 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-(2,3,4,5-tetrahydroxy-6-methyloxan-2-yl)oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
| SMILES | CC1OC(O)(OC2CCC3(C=O)C4CCC5(C)C(C6=CC(=O)OC6)CCC5(O)C4CCC3(O)C2)C(O)C(O)C1O |
| InChI | InChI=1S/C29H42O11/c1-15-22(32)23(33)24(34)29(37,39-15)40-17-3-8-26(14-30)19-4-7-25(2)18(16-11-21(31)38-13-16)6-10-28(25,36)20(19)5-9-27(26,35)12-17/h11,14-15,17-20,22-24,32-37H,3-10,12-13H2,1-2H3 |
| InChIKey | DGEAYOOHPVNVFO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.64 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|