C25H32Cl2O7 — CID 145453240
[(3S,5S,8R,9S,10S,13R,14S,17R)-10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2-dichloroacetate (PubChem CID 145453240) has the molecular formula C25H32Cl2O7 and a molecular weight of 515.43 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13R,14S,17R)-10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2-dichloroacetate.
| Compound Name | [(3S,5S,8R,9S,10S,13R,14S,17R)-10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2-dichloroacetate |
|---|---|
| PubChem CID | 145453240 |
| Molecular Formula | C25H32Cl2O7 |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13R,14S,17R)-10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2-dichloroacetate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@]4(O)C[C@@H](OC(=O)C(Cl)Cl)CC[C@]34C=O)[C@@]1(O)CC[C@@H]2C1=CC(=O)OC1 |
| InChI | InChI=1S/C25H32Cl2O7/c1-22-6-3-17-18(25(22,32)9-5-16(22)14-10-19(29)33-12-14)4-8-24(31)11-15(34-21(30)20(26)27)2-7-23(17,24)13-28/h10,13,15-18,20,31-32H,2-9,11-12H2,1H3/t15-,16+,17-,18+,22+,23-,24-,25-/m0/s1 |
| InChIKey | SQIWMJMCUOYTAJ-STSYQORBSA-N |
| XLogP | 3.25 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|