C28H42BrNO7 — CID 75062490
[2-[[10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethyl]-trimethylazanium bromide (PubChem CID 75062490) has the molecular formula C28H42BrNO7 and a molecular weight of 584.55 g/mol. Its IUPAC name is [2-[[10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethyl]-trimethylazanium bromide.
| Compound Name | [2-[[10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethyl]-trimethylazanium bromide |
|---|---|
| PubChem CID | 75062490 |
| Molecular Formula | C28H42BrNO7 |
| Molecular Weight | 584.55 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | [2-[[10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethyl]-trimethylazanium bromide |
| SMILES | CC12CCC3C(CCC4(O)CC(OC(=O)C[N+](C)(C)C)CCC34C=O)C1(O)CCC2C1=CC(=O)OC1.[Br-] |
| InChI | InChI=1S/C28H42NO7.BrH/c1-25-9-6-21-22(28(25,34)12-8-20(25)18-13-23(31)35-16-18)7-11-27(33)14-19(5-10-26(21,27)17-30)36-24(32)15-29(2,3)4;/h13,17,19-22,33-34H,5-12,14-16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | VKCZUXLVBGMPNV-UHFFFAOYSA-M |
| XLogP | -0.84 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.55 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|