C25H33N2O7+ — CID 6332431
[2-[[10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethylidene]-iminoazanium (PubChem CID 6332431) has the molecular formula C25H33N2O7+ and a molecular weight of 473.55 g/mol. Its IUPAC name is [2-[[10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethylidene]-iminoazanium.
| Compound Name | [2-[[10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethylidene]-iminoazanium |
|---|---|
| PubChem CID | 6332431 |
| Molecular Formula | C25H33N2O7+ |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | [2-[[10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-oxoethylidene]-iminoazanium |
| SMILES | CC12CCC3C(CCC4(O)CC(OC(=O)C=[N+]=N)CCC34C=O)C1(O)CCC2C1=CC(=O)OC1 |
| InChI | InChI=1S/C25H33N2O7/c1-22-6-3-18-19(25(22,32)9-5-17(22)15-10-20(29)33-13-15)4-8-24(31)11-16(34-21(30)12-27-26)2-7-23(18,24)14-28/h10,12,14,16-19,26,31-32H,2-9,11,13H2,1H3/q+1 |
| InChIKey | BVIYPJDGKRCTRB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 148.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|