C25H33ClO7 — CID 4543660
[6-chloro-10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 4543660) has the molecular formula C25H33ClO7 and a molecular weight of 480.99 g/mol. Its IUPAC name is [6-chloro-10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [6-chloro-10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 4543660 |
| Molecular Formula | C25H33ClO7 |
| Molecular Weight | 480.99 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | [6-chloro-10-formyl-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C=O)C3CCC4(C)C(C5=CC(=O)OC5)CCC4(O)C3CC(Cl)C2(O)C1 |
| InChI | InChI=1S/C25H33ClO7/c1-14(28)33-16-3-7-23(13-27)18-4-6-22(2)17(15-9-21(29)32-12-15)5-8-24(22,30)19(18)10-20(26)25(23,31)11-16/h9,13,16-20,30-31H,3-8,10-12H2,1-2H3 |
| InChIKey | GUAJYQUIMFAYNN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.99 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|