C18H25N3OS — CID 163017928
1-[[(2R,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 163017928) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is 1-[[(2R,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[[(2R,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 163017928 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-[[(2R,4R,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | C=C[C@H]1CN2CC[C@@H]1C[C@@H]2CNC(=O)Nc1cccc(SC)c1 |
| InChI | InChI=1S/C18H25N3OS/c1-3-13-12-21-8-7-14(13)9-16(21)11-19-18(22)20-15-5-4-6-17(10-15)23-2/h3-6,10,13-14,16H,1,7-9,11-12H2,2H3,(H2,19,20,22)/t13-,14+,16+/m0/s1 |
| InChIKey | UVGODZFGOFTLTJ-SQWLQELKSA-N |
| XLogP | 3.43 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|