C29H36O9 — CID 163019828
(1R,3S,4S,7R,8R,11S,12S,17S,19R,23R,27S)-11-hydroxy-3,7-dimethyl-8-(5-oxo-2H-furan-3-yl)-18,20,24,26,28-pentaoxaheptacyclo[15.11.0.03,15.04,12.07,11.019,27.023,27]octacos-15-en-6-one (PubChem CID 163019828) has the molecular formula C29H36O9 and a molecular weight of 528.60 g/mol. Its IUPAC name is (1R,3S,4S,7R,8R,11S,12S,17S,19R,23R,27S)-11-hydroxy-3,7-dimethyl-8-(5-oxo-2H-furan-3-yl)-18,20,24,26,28-pentaoxaheptacyclo[15.11.0.03,15.04,12.07,11.019,27.023,27]octacos-15-en-6-one.
| Compound Name | (1R,3S,4S,7R,8R,11S,12S,17S,19R,23R,27S)-11-hydroxy-3,7-dimethyl-8-(5-oxo-2H-furan-3-yl)-18,20,24,26,28-pentaoxaheptacyclo[15.11.0.03,15.04,12.07,11.019,27.023,27]octacos-15-en-6-one |
|---|---|
| PubChem CID | 163019828 |
| Molecular Formula | C29H36O9 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | (1R,3S,4S,7R,8R,11S,12S,17S,19R,23R,27S)-11-hydroxy-3,7-dimethyl-8-(5-oxo-2H-furan-3-yl)-18,20,24,26,28-pentaoxaheptacyclo[15.11.0.03,15.04,12.07,11.019,27.023,27]octacos-15-en-6-one |
| SMILES | C[C@@]12C[C@H]3O[C@]45OCO[C@@H]4CCO[C@@H]5O[C@H]3C=C1CC[C@H]1[C@@H]2CC(=O)[C@]2(C)[C@@H](C3=CC(=O)OC3)CC[C@]12O |
| InChI | InChI=1S/C29H36O9/c1-26-12-21-20(37-25-29(38-21)23(6-8-33-25)35-14-36-29)10-16(26)3-4-18-19(26)11-22(30)27(2)17(5-7-28(18,27)32)15-9-24(31)34-13-15/h9-10,17-21,23,25,32H,3-8,11-14H2,1-2H3/t17-,18+,19+,20+,21-,23-,25-,26-,27+,28+,29-/m1/s1 |
| InChIKey | PNPIICKZCCMCBC-VZMNEZBZSA-N |
| XLogP | 2.55 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|