C29H38O10 — CID 162860617
9,10,17,22-tetrahydroxy-7,14,18-trimethyl-19-(5-oxo-2H-furan-3-yl)-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacos-1-en-16-one (PubChem CID 162860617) has the molecular formula C29H38O10 and a molecular weight of 546.61 g/mol. Its IUPAC name is 9,10,17,22-tetrahydroxy-7,14,18-trimethyl-19-(5-oxo-2H-furan-3-yl)-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacos-1-en-16-one.
| Compound Name | 9,10,17,22-tetrahydroxy-7,14,18-trimethyl-19-(5-oxo-2H-furan-3-yl)-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacos-1-en-16-one |
|---|---|
| PubChem CID | 162860617 |
| Molecular Formula | C29H38O10 |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | 9,10,17,22-tetrahydroxy-7,14,18-trimethyl-19-(5-oxo-2H-furan-3-yl)-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacos-1-en-16-one |
| SMILES | CC1CC(O)C2(O)OC3CC4(C)C(=CC3OC2O1)CCC1C4C(=O)C(O)C2(C)C(C3=CC(=O)OC3)CCC12O |
| InChI | InChI=1S/C29H38O10/c1-13-8-20(30)29(35)25(37-13)38-18-10-15-4-5-17-22(26(15,2)11-19(18)39-29)23(32)24(33)27(3)16(6-7-28(17,27)34)14-9-21(31)36-12-14/h9-10,13,16-20,22,24-25,30,33-35H,4-8,11-12H2,1-3H3 |
| InChIKey | SAEHXSAQDPQSJT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|