C29H42O10 — CID 73238342
3-[9,10,22-trihydroxy-7,14-bis(hydroxymethyl)-18-methyl-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosan-19-yl]-2H-furan-5-one (PubChem CID 73238342) has the molecular formula C29H42O10 and a molecular weight of 550.65 g/mol. Its IUPAC name is 3-[9,10,22-trihydroxy-7,14-bis(hydroxymethyl)-18-methyl-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosan-19-yl]-2H-furan-5-one.
| Compound Name | 3-[9,10,22-trihydroxy-7,14-bis(hydroxymethyl)-18-methyl-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosan-19-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 73238342 |
| Molecular Formula | C29H42O10 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 3-[9,10,22-trihydroxy-7,14-bis(hydroxymethyl)-18-methyl-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosan-19-yl]-2H-furan-5-one |
| SMILES | CC12CCC3C(CCC4CC5OC6OC(CO)CC(O)C6(O)OC5CC43CO)C1(O)CCC2C1=CC(=O)OC1 |
| InChI | InChI=1S/C29H42O10/c1-26-6-4-19-20(28(26,34)7-5-18(26)15-8-24(33)36-13-15)3-2-16-9-21-22(11-27(16,19)14-31)39-29(35)23(32)10-17(12-30)37-25(29)38-21/h8,16-23,25,30-32,34-35H,2-7,9-14H2,1H3 |
| InChIKey | HIFCBBCVEWARQA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|