C11H17N — CID 163020641
2-[(2S)-butan-2-yl]-4,5-dimethylpyridine (PubChem CID 163020641) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 2-[(2S)-butan-2-yl]-4,5-dimethylpyridine.
| Compound Name | 2-[(2S)-butan-2-yl]-4,5-dimethylpyridine |
|---|---|
| PubChem CID | 163020641 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2-[(2S)-butan-2-yl]-4,5-dimethylpyridine |
| SMILES | CC[C@H](C)c1cc(C)c(C)cn1 |
| InChI | InChI=1S/C11H17N/c1-5-8(2)11-6-9(3)10(4)7-12-11/h6-8H,5H2,1-4H3/t8-/m0/s1 |
| InChIKey | NBZHGWVSBQLDMM-QMMMGPOBSA-N |
| XLogP | 3.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |