C15H18O — CID 163023474
(4R,5E,7E,13E)-pentadeca-5,7,13-trien-9,11-diyn-4-ol (PubChem CID 163023474) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is (4R,5E,7E,13E)-pentadeca-5,7,13-trien-9,11-diyn-4-ol.
| Compound Name | (4R,5E,7E,13E)-pentadeca-5,7,13-trien-9,11-diyn-4-ol |
|---|---|
| PubChem CID | 163023474 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (4R,5E,7E,13E)-pentadeca-5,7,13-trien-9,11-diyn-4-ol |
| SMILES | C/C=C/C#CC#C/C=C/C=C/[C@H](O)CCC |
| InChI | InChI=1S/C15H18O/c1-3-5-6-7-8-9-10-11-12-14-15(16)13-4-2/h3,5,10-12,14-16H,4,13H2,1-2H3/b5-3+,11-10+,14-12+/t15-/m1/s1 |
| InChIKey | ZUECWYDJLXPMNJ-ZOECRXDISA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|